C19H19ClO4 — CID 22683970
3-[3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 22683970) has the molecular formula C19H19ClO4 and a molecular weight of 346.81 g/mol. Its IUPAC name is 3-[3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22683970 |
| Molecular Formula | C19H19ClO4 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-[3-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(OCCOc2cccc(C=CC(=O)O)c2)cc(C)c1Cl |
| InChI | InChI=1S/C19H19ClO4/c1-13-10-17(11-14(2)19(13)20)24-9-8-23-16-5-3-4-15(12-16)6-7-18(21)22/h3-7,10-12H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | MMZQJQAPIAAUHH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|