C23H21ClO4 — CID 20990772
3-[2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]naphthalen-1-yl]prop-2-enoic acid (PubChem CID 20990772) has the molecular formula C23H21ClO4 and a molecular weight of 396.87 g/mol. Its IUPAC name is 3-[2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]naphthalen-1-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]naphthalen-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20990772 |
| Molecular Formula | C23H21ClO4 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-[2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]naphthalen-1-yl]prop-2-enoic acid |
| SMILES | Cc1cc(OCCOc2ccc3ccccc3c2C=CC(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C23H21ClO4/c1-15-13-18(14-16(2)23(15)24)27-11-12-28-21-9-7-17-5-3-4-6-19(17)20(21)8-10-22(25)26/h3-10,13-14H,11-12H2,1-2H3,(H,25,26) |
| InChIKey | MMZQIWIQOAWOIU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|