C18H19ClO4 — CID 175656787
2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid (PubChem CID 175656787) has the molecular formula C18H19ClO4 and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid.
| Compound Name | 2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 175656787 |
| Molecular Formula | C18H19ClO4 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(OCCOc2cc(C)c(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C18H19ClO4/c1-11-4-5-15(18(20)21)16(8-11)23-7-6-22-14-9-12(2)17(19)13(3)10-14/h4-5,8-10H,6-7H2,1-3H3,(H,20,21) |
| InChIKey | PJTNHWNRJZSYNA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|