C12H13F3O3 — CID 113326212
4-methyl-2-(4,4,4-trifluorobutoxy)benzoic acid (PubChem CID 113326212) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 4-methyl-2-(4,4,4-trifluorobutoxy)benzoic acid.
| Compound Name | 4-methyl-2-(4,4,4-trifluorobutoxy)benzoic acid |
|---|---|
| PubChem CID | 113326212 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-methyl-2-(4,4,4-trifluorobutoxy)benzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(OCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3O3/c1-8-3-4-9(11(16)17)10(7-8)18-6-2-5-12(13,14)15/h3-4,7H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | JSBACVLWMPHYTD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|