C11H12F4O — CID 115518687
1-fluoro-4-methyl-2-(4,4,4-trifluorobutoxy)benzene (PubChem CID 115518687) has the molecular formula C11H12F4O and a molecular weight of 236.21 g/mol. Its IUPAC name is 1-fluoro-4-methyl-2-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 1-fluoro-4-methyl-2-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 115518687 |
| Molecular Formula | C11H12F4O |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-fluoro-4-methyl-2-(4,4,4-trifluorobutoxy)benzene |
| SMILES | Cc1ccc(F)c(OCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F4O/c1-8-3-4-9(12)10(7-8)16-6-2-5-11(13,14)15/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | ZYFPMVIQXIKNJN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|