C11H12BF6KO — CID 115514502
potassium trifluoro-[5-methyl-2-(4,4,4-trifluorobutoxy)phenyl]boranuide (PubChem CID 115514502) has the molecular formula C11H12BF6KO and a molecular weight of 324.11 g/mol. Its IUPAC name is potassium trifluoro-[5-methyl-2-(4,4,4-trifluorobutoxy)phenyl]boranuide.
| Compound Name | potassium trifluoro-[5-methyl-2-(4,4,4-trifluorobutoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 115514502 |
| Molecular Formula | C11H12BF6KO |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | potassium trifluoro-[5-methyl-2-(4,4,4-trifluorobutoxy)phenyl]boranuide |
| SMILES | Cc1ccc(OCCCC(F)(F)F)c([B-](F)(F)F)c1.[K+] |
| InChI | InChI=1S/C11H12BF6O.K/c1-8-3-4-10(9(7-8)12(16,17)18)19-6-2-5-11(13,14)15;/h3-4,7H,2,5-6H2,1H3;/q-1;+1 |
| InChIKey | KJSIMMQVUZMJKK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|