C13H15BF3KN2O — CID 114528517
potassium trifluoro-[5-methyl-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide (PubChem CID 114528517) has the molecular formula C13H15BF3KN2O and a molecular weight of 322.18 g/mol. Its IUPAC name is potassium trifluoro-[5-methyl-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide.
| Compound Name | potassium trifluoro-[5-methyl-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide |
|---|---|
| PubChem CID | 114528517 |
| Molecular Formula | C13H15BF3KN2O |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | potassium trifluoro-[5-methyl-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide |
| SMILES | Cc1ccc(OCCc2nccn2C)c([B-](F)(F)F)c1.[K+] |
| InChI | InChI=1S/C13H15BF3N2O.K/c1-10-3-4-12(11(9-10)14(15,16)17)20-8-5-13-18-6-7-19(13)2;/h3-4,6-7,9H,5,8H2,1-2H3;/q-1;+1 |
| InChIKey | RIUPFGSCJIFUSP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|