C12H13BF3KN2O — CID 114528509
potassium trifluoro-[2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide (PubChem CID 114528509) has the molecular formula C12H13BF3KN2O and a molecular weight of 308.15 g/mol. Its IUPAC name is potassium trifluoro-[2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide.
| Compound Name | potassium trifluoro-[2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide |
|---|---|
| PubChem CID | 114528509 |
| Molecular Formula | C12H13BF3KN2O |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | potassium trifluoro-[2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boranuide |
| SMILES | Cn1ccnc1CCOc1ccccc1[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C12H13BF3N2O.K/c1-18-8-7-17-12(18)6-9-19-11-5-3-2-4-10(11)13(14,15)16;/h2-5,7-8H,6,9H2,1H3;/q-1;+1 |
| InChIKey | XQSSVUQKFWWASW-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|