C11H12BF6KO2 — CID 104706270
potassium trifluoro-[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boranuide (PubChem CID 104706270) has the molecular formula C11H12BF6KO2 and a molecular weight of 340.11 g/mol. Its IUPAC name is potassium trifluoro-[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boranuide.
| Compound Name | potassium trifluoro-[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 104706270 |
| Molecular Formula | C11H12BF6KO2 |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | potassium trifluoro-[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boranuide |
| SMILES | COc1ccc(OCCCC(F)(F)F)c([B-](F)(F)F)c1.[K+] |
| InChI | InChI=1S/C11H12BF6O2.K/c1-19-8-3-4-10(9(7-8)12(16,17)18)20-6-2-5-11(13,14)15;/h3-4,7H,2,5-6H2,1H3;/q-1;+1 |
| InChIKey | ZTOGAENPGDKORP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|