C12H13F3O5S — CID 69343735
5-methylsulfonyl-2-(4,4,4-trifluorobutoxy)benzoic acid (PubChem CID 69343735) has the molecular formula C12H13F3O5S and a molecular weight of 326.29 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(4,4,4-trifluorobutoxy)benzoic acid.
| Compound Name | 5-methylsulfonyl-2-(4,4,4-trifluorobutoxy)benzoic acid |
|---|---|
| PubChem CID | 69343735 |
| Molecular Formula | C12H13F3O5S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-methylsulfonyl-2-(4,4,4-trifluorobutoxy)benzoic acid |
| SMILES | CS(=O)(=O)c1ccc(OCCCC(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H13F3O5S/c1-21(18,19)8-3-4-10(9(7-8)11(16)17)20-6-2-5-12(13,14)15/h3-4,7H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | OIRIOSYPBVGNJJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|