C11H13ClO7S2 — CID 63190979
5-chlorosulfonyl-2-(3-methylsulfonylpropoxy)benzoic acid (PubChem CID 63190979) has the molecular formula C11H13ClO7S2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 5-chlorosulfonyl-2-(3-methylsulfonylpropoxy)benzoic acid.
| Compound Name | 5-chlorosulfonyl-2-(3-methylsulfonylpropoxy)benzoic acid |
|---|---|
| PubChem CID | 63190979 |
| Molecular Formula | C11H13ClO7S2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 5-chlorosulfonyl-2-(3-methylsulfonylpropoxy)benzoic acid |
| SMILES | CS(=O)(=O)CCCOc1ccc(S(=O)(=O)Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H13ClO7S2/c1-20(15,16)6-2-5-19-10-4-3-8(21(12,17)18)7-9(10)11(13)14/h3-4,7H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | ZYTKRGGDANHUDA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|