C12H12BrF3O2 — CID 82972076
1-[4-bromo-2-(4,4,4-trifluorobutoxy)phenyl]ethanone (PubChem CID 82972076) has the molecular formula C12H12BrF3O2 and a molecular weight of 325.12 g/mol. Its IUPAC name is 1-[4-bromo-2-(4,4,4-trifluorobutoxy)phenyl]ethanone.
| Compound Name | 1-[4-bromo-2-(4,4,4-trifluorobutoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 82972076 |
| Molecular Formula | C12H12BrF3O2 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 1-[4-bromo-2-(4,4,4-trifluorobutoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Br)cc1OCCCC(F)(F)F |
| InChI | InChI=1S/C12H12BrF3O2/c1-8(17)10-4-3-9(13)7-11(10)18-6-2-5-12(14,15)16/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | SMFLYFVCJDLOFE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|