C24H22ClNO5 — CID 7139986
(E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2-methoxynaphthalen-1-yl)prop-2-enoic acid (PubChem CID 7139986) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2-methoxynaphthalen-1-yl)prop-2-enoic acid.
| Compound Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2-methoxynaphthalen-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 7139986 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2-methoxynaphthalen-1-yl)prop-2-enoic acid |
| SMILES | COc1ccc2ccccc2c1/C=C(/NC(=O)COc1cc(C)c(Cl)c(C)c1)C(=O)O |
| InChI | InChI=1S/C24H22ClNO5/c1-14-10-17(11-15(2)23(14)25)31-13-22(27)26-20(24(28)29)12-19-18-7-5-4-6-16(18)8-9-21(19)30-3/h4-12H,13H2,1-3H3,(H,26,27)(H,28,29)/b20-12+ |
| InChIKey | ACWHJGWAOLAKCE-UDWIEESQSA-N |
| XLogP | 4.74 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|