C26H23Cl2NO5 — CID 7139958
(E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 7139958) has the molecular formula C26H23Cl2NO5 and a molecular weight of 500.38 g/mol. Its IUPAC name is (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 7139958 |
| Molecular Formula | C26H23Cl2NO5 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(OCC(=O)N/C(=C/c2ccc(OCc3ccc(Cl)cc3)cc2)C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C26H23Cl2NO5/c1-16-11-22(12-17(2)25(16)28)34-15-24(30)29-23(26(31)32)13-18-5-9-21(10-6-18)33-14-19-3-7-20(27)8-4-19/h3-13H,14-15H2,1-2H3,(H,29,30)(H,31,32)/b23-13+ |
| InChIKey | WGSTXCFBSOFOBE-YDZHTSKRSA-N |
| XLogP | 5.81 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|