C23H18ClNO4 — CID 4772674
2-benzamido-3-[3-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 4772674) has the molecular formula C23H18ClNO4 and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-benzamido-3-[3-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 2-benzamido-3-[3-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4772674 |
| Molecular Formula | C23H18ClNO4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-benzamido-3-[3-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1cccc(OCc2ccc(Cl)cc2)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18ClNO4/c24-19-11-9-16(10-12-19)15-29-20-8-4-5-17(13-20)14-21(23(27)28)25-22(26)18-6-2-1-3-7-18/h1-14H,15H2,(H,25,26)(H,27,28) |
| InChIKey | MLQJORAPJJCLTI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|