C17H13ClO5 — CID 91935361
4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid (PubChem CID 91935361) has the molecular formula C17H13ClO5 and a molecular weight of 332.74 g/mol. Its IUPAC name is 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 91935361 |
| Molecular Formula | C17H13ClO5 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H13ClO5/c18-13-6-4-11(5-7-13)10-23-14-3-1-2-12(8-14)15(19)9-16(20)17(21)22/h1-8H,9-10H2,(H,21,22) |
| InChIKey | KDAOPAWDLZGMGF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|