4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid

C17H13ClO5 — CID 91935361

IUPAC4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid
SMILESO=C(O)C(=O)CC(=O)c1cccc(OCc2ccc(Cl)cc2)c1
InChIInChI=1S/C17H13ClO5/c18-13-6-4-11(5-7-13)10-23-14-3-1-2-12(8-14)15(19)9-16(20)17(21)22/h1-8H,9-10H2,(H,21,22)
InChIKeyKDAOPAWDLZGMGF-UHFFFAOYSA-N
MW332.74 g/mol
LogP3.15
Rot. Bonds7

About 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid

4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid (PubChem CID 91935361) has the molecular formula C17H13ClO5 and a molecular weight of 332.74 g/mol. Its IUPAC name is 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid.

Molecular Properties

Compound Name4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid
PubChem CID91935361
Molecular FormulaC17H13ClO5
Molecular Weight332.74 g/mol
Exact Mass332.05
IUPAC Name4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid
SMILESO=C(O)C(=O)CC(=O)c1cccc(OCc2ccc(Cl)cc2)c1
InChIInChI=1S/C17H13ClO5/c18-13-6-4-11(5-7-13)10-23-14-3-1-2-12(8-14)15(19)9-16(20)17(21)22/h1-8H,9-10H2,(H,21,22)
InChIKeyKDAOPAWDLZGMGF-UHFFFAOYSA-N
XLogP3.15
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.74
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid?
The IUPAC name of 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid (CID 91935361) is 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid.
What is the SMILES notation for 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid?
The canonical SMILES for 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid is O=C(O)C(=O)CC(=O)c1cccc(OCc2ccc(Cl)cc2)c1.
What is the InChIKey of 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid?
The InChIKey is KDAOPAWDLZGMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClO5/c18-13-6-4-11(5-7-13)10-23-14-3-1-2-12(8-14)15(19)9-16(20)17(21)22/h1-8H,9-10H2,(H,21,22).
What are the key properties of 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid?
4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid has a molecular weight of 332.74 g/mol, XLogP of 3.15, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(4-chlorophenyl)methoxy]phenyl]-2,4-dioxobutanoic acid is sourced from PubChem (CID 91935361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).