C23H18O5 — CID 510734
2,4-dioxo-4-[3-[(2-phenylphenyl)methoxy]phenyl]butanoic acid (PubChem CID 510734) has the molecular formula C23H18O5 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2,4-dioxo-4-[3-[(2-phenylphenyl)methoxy]phenyl]butanoic acid.
| Compound Name | 2,4-dioxo-4-[3-[(2-phenylphenyl)methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 510734 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2,4-dioxo-4-[3-[(2-phenylphenyl)methoxy]phenyl]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(OCc2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H18O5/c24-21(14-22(25)23(26)27)17-10-6-11-19(13-17)28-15-18-9-4-5-12-20(18)16-7-2-1-3-8-16/h1-13H,14-15H2,(H,26,27) |
| InChIKey | PSBGTFAYORQOQJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|