C20H20ClNO4 — CID 119173769
(3S)-1-[3-[(4-chlorophenyl)methoxy]benzoyl]piperidine-3-carboxylic acid (PubChem CID 119173769) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is (3S)-1-[3-[(4-chlorophenyl)methoxy]benzoyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[3-[(4-chlorophenyl)methoxy]benzoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119173769 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (3S)-1-[3-[(4-chlorophenyl)methoxy]benzoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2cccc(OCc3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C20H20ClNO4/c21-17-8-6-14(7-9-17)13-26-18-5-1-3-15(11-18)19(23)22-10-2-4-16(12-22)20(24)25/h1,3,5-9,11,16H,2,4,10,12-13H2,(H,24,25)/t16-/m0/s1 |
| InChIKey | JLACSWDFVHVDDZ-INIZCTEOSA-N |
| XLogP | 3.86 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |