C25H29ClN2O3 — CID 92900752
[3-[[(3S)-1-(3-chlorobenzoyl)piperidin-3-yl]methoxy]phenyl]-piperidin-1-ylmethanone (PubChem CID 92900752) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is [3-[[(3S)-1-(3-chlorobenzoyl)piperidin-3-yl]methoxy]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-[[(3S)-1-(3-chlorobenzoyl)piperidin-3-yl]methoxy]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 92900752 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [3-[[(3S)-1-(3-chlorobenzoyl)piperidin-3-yl]methoxy]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cccc(OC[C@H]2CCCN(C(=O)c3cccc(Cl)c3)C2)c1)N1CCCCC1 |
| InChI | InChI=1S/C25H29ClN2O3/c26-22-10-4-8-20(15-22)25(30)28-14-6-7-19(17-28)18-31-23-11-5-9-21(16-23)24(29)27-12-2-1-3-13-27/h4-5,8-11,15-16,19H,1-3,6-7,12-14,17-18H2/t19-/m0/s1 |
| InChIKey | KSFKXNZVTAUYPJ-IBGZPJMESA-N |
| XLogP | 4.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |