C24H26ClFN2O3 — CID 50846654
[3-[[1-(2-chloro-5-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 50846654) has the molecular formula C24H26ClFN2O3 and a molecular weight of 444.93 g/mol. Its IUPAC name is [3-[[1-(2-chloro-5-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[[1-(2-chloro-5-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 50846654 |
| Molecular Formula | C24H26ClFN2O3 |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [3-[[1-(2-chloro-5-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cccc(OCC2CCCN(C(=O)c3cc(F)ccc3Cl)C2)c1)N1CCCC1 |
| InChI | InChI=1S/C24H26ClFN2O3/c25-22-9-8-19(26)14-21(22)24(30)28-12-4-5-17(15-28)16-31-20-7-3-6-18(13-20)23(29)27-10-1-2-11-27/h3,6-9,13-14,17H,1-2,4-5,10-12,15-16H2 |
| InChIKey | TXGKNTDIHRCZFJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |