C25H30N2O3 — CID 50847103
[3-[[1-(2-methylbenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 50847103) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is [3-[[1-(2-methylbenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[[1-(2-methylbenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 50847103 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [3-[[1-(2-methylbenzoyl)piperidin-3-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccccc1C(=O)N1CCCC(COc2cccc(C(=O)N3CCCC3)c2)C1 |
| InChI | InChI=1S/C25H30N2O3/c1-19-8-2-3-12-23(19)25(29)27-15-7-9-20(17-27)18-30-22-11-6-10-21(16-22)24(28)26-13-4-5-14-26/h2-3,6,8,10-12,16,20H,4-5,7,9,13-15,17-18H2,1H3 |
| InChIKey | VGTRSEMJQCBYPD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |