C17H17NO4S — CID 124703583
(3S)-1-[3-(thiophen-2-ylmethoxy)benzoyl]pyrrolidine-3-carboxylic acid (PubChem CID 124703583) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is (3S)-1-[3-(thiophen-2-ylmethoxy)benzoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-[3-(thiophen-2-ylmethoxy)benzoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124703583 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (3S)-1-[3-(thiophen-2-ylmethoxy)benzoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN(C(=O)c2cccc(OCc3cccs3)c2)C1 |
| InChI | InChI=1S/C17H17NO4S/c19-16(18-7-6-13(10-18)17(20)21)12-3-1-4-14(9-12)22-11-15-5-2-8-23-15/h1-5,8-9,13H,6-7,10-11H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | DVDAGRLFDLBSDO-ZDUSSCGKSA-N |
| XLogP | 2.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |