C22H21ClN2O2S — CID 39896443
[4-(3-chlorophenyl)piperazin-1-yl]-[3-(thiophen-2-ylmethoxy)phenyl]methanone (PubChem CID 39896443) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-[3-(thiophen-2-ylmethoxy)phenyl]methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-[3-(thiophen-2-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 39896443 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-[3-(thiophen-2-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1cccc(OCc2cccs2)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H21ClN2O2S/c23-18-5-2-6-19(15-18)24-9-11-25(12-10-24)22(26)17-4-1-7-20(14-17)27-16-21-8-3-13-28-21/h1-8,13-15H,9-12,16H2 |
| InChIKey | BIRLMEYFNFFXPC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |