C18H14ClNO3S — CID 56581143
N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethoxy)benzamide (PubChem CID 56581143) has the molecular formula C18H14ClNO3S and a molecular weight of 359.83 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethoxy)benzamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 56581143 |
| Molecular Formula | C18H14ClNO3S |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1cccc(OCc2cccs2)c1 |
| InChI | InChI=1S/C18H14ClNO3S/c19-13-6-7-17(21)16(10-13)20-18(22)12-3-1-4-14(9-12)23-11-15-5-2-8-24-15/h1-10,21H,11H2,(H,20,22) |
| InChIKey | JGMFUTSHHCYNGR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|