C18H15ClN2O4S2 — CID 56581239
N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 56581239) has the molecular formula C18H15ClN2O4S2 and a molecular weight of 422.92 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 56581239 |
| Molecular Formula | C18H15ClN2O4S2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1cccc(S(=O)(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C18H15ClN2O4S2/c19-13-6-7-17(22)16(10-13)21-18(23)12-3-1-5-15(9-12)27(24,25)20-11-14-4-2-8-26-14/h1-10,20,22H,11H2,(H,21,23) |
| InChIKey | JIGZRXSLTXYOAT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|