C22H21N3O4S2 — CID 17439047
N-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 17439047) has the molecular formula C22H21N3O4S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 17439047 |
| Molecular Formula | C22H21N3O4S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1=O)c1cccc(S(=O)(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C22H21N3O4S2/c26-21-11-4-12-25(21)20-10-2-1-9-19(20)24-22(27)16-6-3-8-18(14-16)31(28,29)23-15-17-7-5-13-30-17/h1-3,5-10,13-14,23H,4,11-12,15H2,(H,24,27) |
| InChIKey | RYJULVCBPUCYFJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |