C22H20N4O5S2 — CID 30006239
N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 30006239) has the molecular formula C22H20N4O5S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 30006239 |
| Molecular Formula | C22H20N4O5S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(NC(=O)c2cccc(S(=O)(=O)NCc3cccs3)c2)C1=O |
| InChI | InChI=1S/C22H20N4O5S2/c1-22(16-8-3-2-4-9-16)20(28)26(21(29)24-22)25-19(27)15-7-5-11-18(13-15)33(30,31)23-14-17-10-6-12-32-17/h2-13,23H,14H2,1H3,(H,24,29)(H,25,27)/t22-/m0/s1 |
| InChIKey | NHABPEDLUFKJCG-QFIPXVFZSA-N |
| XLogP | 2.34 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|