C23H19ClN4O5S — CID 55369820
3-[(2-chlorophenyl)sulfamoyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide (PubChem CID 55369820) has the molecular formula C23H19ClN4O5S and a molecular weight of 498.95 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfamoyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide.
| Compound Name | 3-[(2-chlorophenyl)sulfamoyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55369820 |
| Molecular Formula | C23H19ClN4O5S |
| Molecular Weight | 498.95 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfamoyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
| SMILES | CC1(c2ccccc2)NC(=O)N(NC(=O)c2cccc(S(=O)(=O)Nc3ccccc3Cl)c2)C1=O |
| InChI | InChI=1S/C23H19ClN4O5S/c1-23(16-9-3-2-4-10-16)21(30)28(22(31)25-23)26-20(29)15-8-7-11-17(14-15)34(32,33)27-19-13-6-5-12-18(19)24/h2-14,27H,1H3,(H,25,31)(H,26,29) |
| InChIKey | BCYOYMLZXMFBSL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.95 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|