C21H22N4O5S — CID 41203446
N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 41203446) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41203446 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(NC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1=O |
| InChI | InChI=1S/C21H22N4O5S/c1-21(16-7-3-2-4-8-16)19(27)25(20(28)22-21)23-18(26)15-9-11-17(12-10-15)31(29,30)24-13-5-6-14-24/h2-4,7-12H,5-6,13-14H2,1H3,(H,22,28)(H,23,26)/t21-/m0/s1 |
| InChIKey | LHGVOANAUXJEQK-NRFANRHFSA-N |
| XLogP | 1.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|