C22H24N4O7S — CID 166185719
N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 166185719) has the molecular formula C22H24N4O7S and a molecular weight of 488.52 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 166185719 |
| Molecular Formula | C22H24N4O7S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(NC(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O7S/c1-22(16-5-7-17(32-2)8-6-16)20(28)26(21(29)23-22)24-19(27)15-3-9-18(10-4-15)34(30,31)25-11-13-33-14-12-25/h3-10H,11-14H2,1-2H3,(H,23,29)(H,24,27) |
| InChIKey | DAQCJCHMFHFJSK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|