C19H19N3O5 — CID 8879493
3,5-dimethoxy-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide (PubChem CID 8879493) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 8879493 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3,5-dimethoxy-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NN2C(=O)N[C@](C)(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C19H19N3O5/c1-19(13-7-5-4-6-8-13)17(24)22(18(25)20-19)21-16(23)12-9-14(26-2)11-15(10-12)27-3/h4-11H,1-3H3,(H,20,25)(H,21,23)/t19-/m1/s1 |
| InChIKey | IEHGCIWHIMJMHA-LJQANCHMSA-N |
| XLogP | 1.82 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|