C23H25N3O5 — CID 55821997
4-cyclopentyloxy-3-methoxy-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide (PubChem CID 55821997) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-methoxy-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide.
| Compound Name | 4-cyclopentyloxy-3-methoxy-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55821997 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 4-cyclopentyloxy-3-methoxy-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
| SMILES | COc1cc(C(=O)NN2C(=O)NC(C)(c3ccccc3)C2=O)ccc1OC1CCCC1 |
| InChI | InChI=1S/C23H25N3O5/c1-23(16-8-4-3-5-9-16)21(28)26(22(29)24-23)25-20(27)15-12-13-18(19(14-15)30-2)31-17-10-6-7-11-17/h3-5,8-9,12-14,17H,6-7,10-11H2,1-2H3,(H,24,29)(H,25,27) |
| InChIKey | IQIGVVFBIBLVLJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|