C21H19N5O5 — CID 40956677
1-ethyl-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 40956677) has the molecular formula C21H19N5O5 and a molecular weight of 421.41 g/mol. Its IUPAC name is 1-ethyl-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 40956677 |
| Molecular Formula | C21H19N5O5 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-ethyl-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NN3C(=O)N[C@](C)(c4ccccc4)C3=O)ccc21 |
| InChI | InChI=1S/C21H19N5O5/c1-3-25-15-10-9-12(11-14(15)22-17(28)18(25)29)16(27)24-26-19(30)21(2,23-20(26)31)13-7-5-4-6-8-13/h4-11H,3H2,1-2H3,(H,22,28)(H,23,31)(H,24,27)/t21-/m1/s1 |
| InChIKey | JBZYREXNLHKFNG-OAQYLSRUSA-N |
| XLogP | 0.82 |
| TPSA | 133.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|