C17H14BrN3O3 — CID 8879406
2-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide (PubChem CID 8879406) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is 2-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide.
| Compound Name | 2-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 8879406 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]benzamide |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(NC(=O)c2ccccc2Br)C1=O |
| InChI | InChI=1S/C17H14BrN3O3/c1-17(11-7-3-2-4-8-11)15(23)21(16(24)19-17)20-14(22)12-9-5-6-10-13(12)18/h2-10H,1H3,(H,19,24)(H,20,22)/t17-/m1/s1 |
| InChIKey | XFYMQTHFUFPZTO-QGZVFWFLSA-N |
| XLogP | 2.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|