C20H21N3O3S — CID 55902374
4-(ethylsulfanylmethyl)-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide (PubChem CID 55902374) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-(ethylsulfanylmethyl)-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide.
| Compound Name | 4-(ethylsulfanylmethyl)-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55902374 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-(ethylsulfanylmethyl)-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)benzamide |
| SMILES | CCSCc1ccc(C(=O)NN2C(=O)NC(C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-3-27-13-14-9-11-15(12-10-14)17(24)22-23-18(25)20(2,21-19(23)26)16-7-5-4-6-8-16/h4-12H,3,13H2,1-2H3,(H,21,26)(H,22,24) |
| InChIKey | QXZRNQLTQDGRLT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|