C15H13BrN4O3 — CID 36779625
4-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-pyrrole-2-carboxamide (PubChem CID 36779625) has the molecular formula C15H13BrN4O3 and a molecular weight of 377.20 g/mol. Its IUPAC name is 4-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 36779625 |
| Molecular Formula | C15H13BrN4O3 |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 4-bromo-N-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-pyrrole-2-carboxamide |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(NC(=O)c2cc(Br)c[nH]2)C1=O |
| InChI | InChI=1S/C15H13BrN4O3/c1-15(9-5-3-2-4-6-9)13(22)20(14(23)18-15)19-12(21)11-7-10(16)8-17-11/h2-8,17H,1H3,(H,18,23)(H,19,21)/t15-/m1/s1 |
| InChIKey | FOKGGJZTKIYCNM-OAHLLOKOSA-N |
| XLogP | 1.89 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|