C17H21N3O6 — CID 167773553
6-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-6-oxohexanoic acid (PubChem CID 167773553) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is 6-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-6-oxohexanoic acid.
| Compound Name | 6-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 167773553 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 6-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-6-oxohexanoic acid |
| SMILES | COc1cccc(C2(C)NC(=O)N(NC(=O)CCCCC(=O)O)C2=O)c1 |
| InChI | InChI=1S/C17H21N3O6/c1-17(11-6-5-7-12(10-11)26-2)15(24)20(16(25)18-17)19-13(21)8-3-4-9-14(22)23/h5-7,10H,3-4,8-9H2,1-2H3,(H,18,25)(H,19,21)(H,22,23) |
| InChIKey | YSENKICXHZJOPY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|