C22H30N6O5 — CID 55469957
2-[4-[2-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55469957) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[4-[2-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[2-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55469957 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 2-[4-[2-[[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(CC(=O)NN2C(=O)NC(C)(c3cccc(OC)c3)C2=O)CC1 |
| InChI | InChI=1S/C22H30N6O5/c1-4-8-23-18(29)14-26-9-11-27(12-10-26)15-19(30)25-28-20(31)22(2,24-21(28)32)16-6-5-7-17(13-16)33-3/h4-7,13H,1,8-12,14-15H2,2-3H3,(H,23,29)(H,24,32)(H,25,30) |
| InChIKey | ROMKWWZNJZLTME-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|