C22H23ClN4O5S — CID 41156656
1-(4-chlorophenyl)sulfonyl-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide (PubChem CID 41156656) has the molecular formula C22H23ClN4O5S and a molecular weight of 490.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41156656 |
| Molecular Formula | C22H23ClN4O5S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(NC(=O)C2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)C1=O |
| InChI | InChI=1S/C22H23ClN4O5S/c1-22(16-5-3-2-4-6-16)20(29)27(21(30)24-22)25-19(28)15-11-13-26(14-12-15)33(31,32)18-9-7-17(23)8-10-18/h2-10,15H,11-14H2,1H3,(H,24,30)(H,25,28)/t22-/m0/s1 |
| InChIKey | OMMJUXKLIUJWBP-QFIPXVFZSA-N |
| XLogP | 2.24 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|