C18H24N4O5S — CID 9452261
1-(benzenesulfonyl)-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]piperidine-4-carboxamide (PubChem CID 9452261) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9452261 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]piperidine-4-carboxamide |
| SMILES | CC[C@]1(C)NC(=O)N(NC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C18H24N4O5S/c1-3-18(2)16(24)22(17(25)19-18)20-15(23)13-9-11-21(12-10-13)28(26,27)14-7-5-4-6-8-14/h4-8,13H,3,9-12H2,1-2H3,(H,19,25)(H,20,23)/t18-/m0/s1 |
| InChIKey | QOTMEZIAKIPCJR-SFHVURJKSA-N |
| XLogP | 0.84 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|