C22H24N4O5S — CID 41208727
1-(benzenesulfonyl)-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide (PubChem CID 41208727) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41208727 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]piperidine-4-carboxamide |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(NC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C22H24N4O5S/c1-22(17-8-4-2-5-9-17)20(28)26(21(29)23-22)24-19(27)16-12-14-25(15-13-16)32(30,31)18-10-6-3-7-11-18/h2-11,16H,12-15H2,1H3,(H,23,29)(H,24,27)/t22-/m0/s1 |
| InChIKey | HDOQBKRZAJGIIV-QFIPXVFZSA-N |
| XLogP | 1.59 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|