C16H22ClN3O3S2 — CID 120829635
N-[2-(methylamino)propyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride (PubChem CID 120829635) has the molecular formula C16H22ClN3O3S2 and a molecular weight of 403.96 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[2-(methylamino)propyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120829635 |
| Molecular Formula | C16H22ClN3O3S2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[2-(methylamino)propyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1.Cl |
| InChI | InChI=1S/C16H21N3O3S2.ClH/c1-12(17-2)10-18-16(20)13-5-3-7-15(9-13)24(21,22)19-11-14-6-4-8-23-14;/h3-9,12,17,19H,10-11H2,1-2H3,(H,18,20);1H |
| InChIKey | BCFTYEIIRMXLSU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |