C18H26ClN3O3S2 — CID 119585485
N-(1-amino-4-methylpentan-2-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119585485) has the molecular formula C18H26ClN3O3S2 and a molecular weight of 432.01 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119585485 |
| Molecular Formula | C18H26ClN3O3S2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1.Cl |
| InChI | InChI=1S/C18H25N3O3S2.ClH/c1-13(2)9-15(11-19)21-18(22)14-5-3-7-17(10-14)26(23,24)20-12-16-6-4-8-25-16;/h3-8,10,13,15,20H,9,11-12,19H2,1-2H3,(H,21,22);1H |
| InChIKey | BBQFUNGQUBYUFA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |