C18H29N3O3S — CID 119585530
N-(1-amino-4-methylpentan-2-yl)-3-(cyclopentylsulfamoyl)benzamide (PubChem CID 119585530) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-(cyclopentylsulfamoyl)benzamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-(cyclopentylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 119585530 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-(cyclopentylsulfamoyl)benzamide |
| SMILES | CC(C)CC(CN)NC(=O)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C18H29N3O3S/c1-13(2)10-16(12-19)20-18(22)14-6-5-9-17(11-14)25(23,24)21-15-7-3-4-8-15/h5-6,9,11,13,15-16,21H,3-4,7-8,10,12,19H2,1-2H3,(H,20,22) |
| InChIKey | OBKAPOYNLPQCGR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |