C22H25N3O3S2 — CID 43016489
N-[2-(dimethylamino)-2-phenylethyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 43016489) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43016489 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | CN(C)C(CNC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-25(2)21(17-8-4-3-5-9-17)16-23-22(26)18-10-6-12-20(14-18)30(27,28)24-15-19-11-7-13-29-19/h3-14,21,24H,15-16H2,1-2H3,(H,23,26) |
| InChIKey | QQKQFSJKVNCOAR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |