C18H16N4O4S2 — CID 35017463
3-[(pyridine-3-carbonylamino)carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 35017463) has the molecular formula C18H16N4O4S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[(pyridine-3-carbonylamino)carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-[(pyridine-3-carbonylamino)carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35017463 |
| Molecular Formula | C18H16N4O4S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 3-[(pyridine-3-carbonylamino)carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1)c1cccnc1 |
| InChI | InChI=1S/C18H16N4O4S2/c23-17(21-22-18(24)14-5-2-8-19-11-14)13-4-1-7-16(10-13)28(25,26)20-12-15-6-3-9-27-15/h1-11,20H,12H2,(H,21,23)(H,22,24) |
| InChIKey | BQSNLNZVDBEHCY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|