C19H19N3O5S2 — CID 35000765
3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 35000765) has the molecular formula C19H19N3O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35000765 |
| Molecular Formula | C19H19N3O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cccc(S(=O)(=O)NCc3cccs3)c2)c(C)o1 |
| InChI | InChI=1S/C19H19N3O5S2/c1-12-9-17(13(2)27-12)19(24)22-21-18(23)14-5-3-7-16(10-14)29(25,26)20-11-15-6-4-8-28-15/h3-10,20H,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | BWXIXBCHQHVCBU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|