C19H17ClN2O3S2 — CID 26717987
N-(4-chloro-2-methylphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 26717987) has the molecular formula C19H17ClN2O3S2 and a molecular weight of 420.94 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26717987 |
| Molecular Formula | C19H17ClN2O3S2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C19H17ClN2O3S2/c1-13-10-15(20)7-8-18(13)22-19(23)14-4-2-6-17(11-14)27(24,25)21-12-16-5-3-9-26-16/h2-11,21H,12H2,1H3,(H,22,23) |
| InChIKey | OVUUIEZIIAJYIK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |