C20H21N3O6S3 — CID 37261170
N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 37261170) has the molecular formula C20H21N3O6S3 and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 37261170 |
| Molecular Formula | C20H21N3O6S3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cccc(S(=O)(=O)NCc3cccs3)c2)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C20H21N3O6S3/c1-29-19-12-15(8-9-18(19)23-31(2,25)26)22-20(24)14-5-3-7-17(11-14)32(27,28)21-13-16-6-4-10-30-16/h3-12,21,23H,13H2,1-2H3,(H,22,24) |
| InChIKey | ZVGOCVMEKVAGGM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |