C17H20N2O6S2 — CID 55618945
N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 55618945) has the molecular formula C17H20N2O6S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 55618945 |
| Molecular Formula | C17H20N2O6S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cccc(CS(C)(=O)=O)c2)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H20N2O6S2/c1-25-16-10-14(7-8-15(16)19-27(3,23)24)18-17(20)13-6-4-5-12(9-13)11-26(2,21)22/h4-10,19H,11H2,1-3H3,(H,18,20) |
| InChIKey | DKCTWXXZXQHDIE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |